C19H25NO4 — CID 146280749
17'-methylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',4'-diol (PubChem CID 146280749) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 17'-methylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',4'-diol.
| Compound Name | 17'-methylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',4'-diol |
|---|---|
| PubChem CID | 146280749 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 17'-methylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',4'-diol |
| SMILES | CN1CCC23CC4(CCC2C1Cc1ccc(O)c(O)c13)OCCO4 |
| InChI | InChI=1S/C19H25NO4/c1-20-7-6-18-11-19(23-8-9-24-19)5-4-13(18)14(20)10-12-2-3-15(21)17(22)16(12)18/h2-3,13-14,21-22H,4-11H2,1H3 |
| InChIKey | WFGCBTXKYYXNNQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|