C52H36N6 — CID 146281335
5-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-11,11-dimethylindeno[1,2-b]carbazole (PubChem CID 146281335) has the molecular formula C52H36N6 and a molecular weight of 744.90 g/mol. Its IUPAC name is 5-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-11,11-dimethylindeno[1,2-b]carbazole.
| Compound Name | 5-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-11,11-dimethylindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 146281335 |
| Molecular Formula | C52H36N6 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 5-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-11,11-dimethylindeno[1,2-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1c(-c2ccccc2)cc(-c2nc(-c3cccnc3)nc(-c3cccnc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C52H36N6/c1-52(2)44-23-11-9-21-38(44)42-30-47-43(29-45(42)52)39-22-10-12-24-46(39)58(47)48-40(33-15-5-3-6-16-33)27-37(28-41(48)34-17-7-4-8-18-34)51-56-49(35-19-13-25-53-31-35)55-50(57-51)36-20-14-26-54-32-36/h3-32H,1-2H3 |
| InChIKey | APZLKIJLRAZUAU-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |