C11H18N2 — CID 146281395
3-methyl-6-piperidin-1-yl-3,4-dihydropyridine (PubChem CID 146281395) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-methyl-6-piperidin-1-yl-3,4-dihydropyridine.
| Compound Name | 3-methyl-6-piperidin-1-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 146281395 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-methyl-6-piperidin-1-yl-3,4-dihydropyridine |
| SMILES | CC1C=NC(N2CCCCC2)=CC1 |
| InChI | InChI=1S/C11H18N2/c1-10-5-6-11(12-9-10)13-7-3-2-4-8-13/h6,9-10H,2-5,7-8H2,1H3 |
| InChIKey | CCRZUFODRFQFTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |