C23H28N4O3S — CID 146284062
3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-pyridin-4-yl-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide (PubChem CID 146284062) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-pyridin-4-yl-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide.
| Compound Name | 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-pyridin-4-yl-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
|---|---|
| PubChem CID | 146284062 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-pyridin-4-yl-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)C2CC2)sc2c1CC(C(=O)Nc1ccncc1)CC2 |
| InChI | InChI=1S/C23H28N4O3S/c1-2-3-10-25-22(30)19-17-13-15(21(29)26-16-8-11-24-12-9-16)6-7-18(17)31-23(19)27-20(28)14-4-5-14/h8-9,11-12,14-15H,2-7,10,13H2,1H3,(H,25,30)(H,27,28)(H,24,26,29) |
| InChIKey | DGHCJEMWQZAHIN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|