C28H34N4O4S — CID 146284145
3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-[3-(5-oxopyrrolidin-3-yl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide (PubChem CID 146284145) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-[3-(5-oxopyrrolidin-3-yl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide.
| Compound Name | 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-[3-(5-oxopyrrolidin-3-yl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
|---|---|
| PubChem CID | 146284145 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 3-N-butyl-2-(cyclopropanecarbonylamino)-5-N-[3-(5-oxopyrrolidin-3-yl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)C2CC2)sc2c1CC(C(=O)Nc1cccc(C3CNC(=O)C3)c1)CC2 |
| InChI | InChI=1S/C28H34N4O4S/c1-2-3-11-29-27(36)24-21-13-18(9-10-22(21)37-28(24)32-25(34)16-7-8-16)26(35)31-20-6-4-5-17(12-20)19-14-23(33)30-15-19/h4-6,12,16,18-19H,2-3,7-11,13-15H2,1H3,(H,29,36)(H,30,33)(H,31,35)(H,32,34) |
| InChIKey | DFQYMJIUOYTWRE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|