C27H39N3O4S — CID 146284097
2-(butanoylamino)-3-N-butyl-5-N-[2-(4-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide (PubChem CID 146284097) has the molecular formula C27H39N3O4S and a molecular weight of 501.69 g/mol. Its IUPAC name is 2-(butanoylamino)-3-N-butyl-5-N-[2-(4-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide.
| Compound Name | 2-(butanoylamino)-3-N-butyl-5-N-[2-(4-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
|---|---|
| PubChem CID | 146284097 |
| Molecular Formula | C27H39N3O4S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-(butanoylamino)-3-N-butyl-5-N-[2-(4-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)CCC)sc2c1CC(C(=O)NCCC1(C)C=CC(O)=CC1)CC2 |
| InChI | InChI=1S/C27H39N3O4S/c1-4-6-15-28-25(34)23-20-17-18(8-9-21(20)35-26(23)30-22(32)7-5-2)24(33)29-16-14-27(3)12-10-19(31)11-13-27/h10-12,18,31H,4-9,13-17H2,1-3H3,(H,28,34)(H,29,33)(H,30,32) |
| InChIKey | OIRBPYSTSPTNMI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|