C19H30N2O2S — CID 146284583
2-(butanoylamino)-N-butyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxamide (PubChem CID 146284583) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-(butanoylamino)-N-butyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(butanoylamino)-N-butyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 146284583 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-(butanoylamino)-N-butyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)CCC)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C19H30N2O2S/c1-5-7-11-20-17(23)16-13-12-19(3,4)10-9-14(13)24-18(16)21-15(22)8-6-2/h5-12H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | PMWYDMQFBLGBQW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|