C22H35NS — CID 153377066
ethenylcyclopropane;N-[1-(2,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenyl]butan-1-amine (PubChem CID 153377066) has the molecular formula C22H35NS and a molecular weight of 345.60 g/mol. Its IUPAC name is ethenylcyclopropane;N-[1-(2,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenyl]butan-1-amine.
| Compound Name | ethenylcyclopropane;N-[1-(2,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenyl]butan-1-amine |
|---|---|
| PubChem CID | 153377066 |
| Molecular Formula | C22H35NS |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | ethenylcyclopropane;N-[1-(2,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenyl]butan-1-amine |
| SMILES | C=C(NCCCC)c1c(C)sc2c1CC(C)(C)CC2.C=CC1CC1 |
| InChI | InChI=1S/C17H27NS.C5H8/c1-6-7-10-18-12(2)16-13(3)19-15-8-9-17(4,5)11-14(15)16;1-2-5-3-4-5/h18H,2,6-11H2,1,3-5H3;2,5H,1,3-4H2 |
| InChIKey | RUGOKKBQKJBABO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|