C27H43NS — CID 153377094
but-1-ene;ethenylcyclopropane;N-[1-(2-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)ethenyl]butan-1-amine (PubChem CID 153377094) has the molecular formula C27H43NS and a molecular weight of 413.72 g/mol. Its IUPAC name is but-1-ene;ethenylcyclopropane;N-[1-(2-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)ethenyl]butan-1-amine.
| Compound Name | but-1-ene;ethenylcyclopropane;N-[1-(2-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)ethenyl]butan-1-amine |
|---|---|
| PubChem CID | 153377094 |
| Molecular Formula | C27H43NS |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | but-1-ene;ethenylcyclopropane;N-[1-(2-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)ethenyl]butan-1-amine |
| SMILES | C=C(NCCCC)c1c(C)sc2c1CC(C(=C)C)CC2.C=CC1CC1.C=CCC |
| InChI | InChI=1S/C18H27NS.C5H8.C4H8/c1-6-7-10-19-13(4)18-14(5)20-17-9-8-15(12(2)3)11-16(17)18;1-2-5-3-4-5;1-3-4-2/h15,19H,2,4,6-11H2,1,3,5H3;2,5H,1,3-4H2;3H,1,4H2,2H3 |
| InChIKey | GAVLQQMROIHXIB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|