C16H23N3O3S — CID 146284607
2-(butanoylamino)-N-ethyl-5-formamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 146284607) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(butanoylamino)-N-ethyl-5-formamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(butanoylamino)-N-ethyl-5-formamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 146284607 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(butanoylamino)-N-ethyl-5-formamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCC(=O)Nc1sc2c(c1C(=O)NCC)CC(NC=O)CC2 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-5-13(21)19-16-14(15(22)17-4-2)11-8-10(18-9-20)6-7-12(11)23-16/h9-10H,3-8H2,1-2H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | MTNCTDWMBIAOIH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|