C19H33FN2 — CID 146290182
(4E,6Z)-N,3-diethyl-1-fluoro-9-methyl-4-(methylideneamino)-N-propyldeca-4,6,9-trien-5-amine (PubChem CID 146290182) has the molecular formula C19H33FN2 and a molecular weight of 308.49 g/mol. Its IUPAC name is (4E,6Z)-N,3-diethyl-1-fluoro-9-methyl-4-(methylideneamino)-N-propyldeca-4,6,9-trien-5-amine.
| Compound Name | (4E,6Z)-N,3-diethyl-1-fluoro-9-methyl-4-(methylideneamino)-N-propyldeca-4,6,9-trien-5-amine |
|---|---|
| PubChem CID | 146290182 |
| Molecular Formula | C19H33FN2 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | (4E,6Z)-N,3-diethyl-1-fluoro-9-methyl-4-(methylideneamino)-N-propyldeca-4,6,9-trien-5-amine |
| SMILES | C=N/C(=C(\C=C/CC(=C)C)N(CC)CCC)C(CC)CCF |
| InChI | InChI=1S/C19H33FN2/c1-7-15-22(9-3)18(12-10-11-16(4)5)19(21-6)17(8-2)13-14-20/h10,12,17H,4,6-9,11,13-15H2,1-3,5H3/b12-10-,19-18+ |
| InChIKey | VGLXMHKBUMXNOO-FZXVIKSRSA-N |
| XLogP | 5.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|