C23H17Cl2N3O3 — CID 146291573
2-[2-[1-[(2,4-dichlorophenyl)methyl]-4H-pyrano[3,4-d]pyrazol-7-ylidene]ethyl]isoindole-1,3-dione (PubChem CID 146291573) has the molecular formula C23H17Cl2N3O3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 2-[2-[1-[(2,4-dichlorophenyl)methyl]-4H-pyrano[3,4-d]pyrazol-7-ylidene]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-[(2,4-dichlorophenyl)methyl]-4H-pyrano[3,4-d]pyrazol-7-ylidene]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146291573 |
| Molecular Formula | C23H17Cl2N3O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-[2-[1-[(2,4-dichlorophenyl)methyl]-4H-pyrano[3,4-d]pyrazol-7-ylidene]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC=C1COCc2cnn(Cc3ccc(Cl)cc3Cl)c21 |
| InChI | InChI=1S/C23H17Cl2N3O3/c24-17-6-5-14(20(25)9-17)11-28-21-15(12-31-13-16(21)10-26-28)7-8-27-22(29)18-3-1-2-4-19(18)23(27)30/h1-7,9-10H,8,11-13H2 |
| InChIKey | OPBORKXDAMSNJA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|