C24H20Cl2N4OS2 — CID 146293836
(3E)-N-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]propanamide (PubChem CID 146293836) has the molecular formula C24H20Cl2N4OS2 and a molecular weight of 515.49 g/mol. Its IUPAC name is (3E)-N-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]propanamide.
| Compound Name | (3E)-N-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]propanamide |
|---|---|
| PubChem CID | 146293836 |
| Molecular Formula | C24H20Cl2N4OS2 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | (3E)-N-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]propanamide |
| SMILES | O=C(C/C=C1\CCCc2cnn(Cc3ccc(Cl)cc3Cl)c21)NSc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H20Cl2N4OS2/c25-18-10-8-17(19(26)12-18)14-30-23-15(4-3-5-16(23)13-27-30)9-11-22(31)29-33-24-28-20-6-1-2-7-21(20)32-24/h1-2,6-10,12-13H,3-5,11,14H2,(H,29,31)/b15-9+ |
| InChIKey | UHGLKOBJUSHEFW-OQLLNIDSSA-N |
| XLogP | 6.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|