C19H28F3NO4 — CID 146295405
tert-butyl 3-[(2-ethoxy-2-methoxyethyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 146295405) has the molecular formula C19H28F3NO4 and a molecular weight of 391.43 g/mol. Its IUPAC name is tert-butyl 3-[(2-ethoxy-2-methoxyethyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[(2-ethoxy-2-methoxyethyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 146295405 |
| Molecular Formula | C19H28F3NO4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | tert-butyl 3-[(2-ethoxy-2-methoxyethyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(CNC(CC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1)OC |
| InChI | InChI=1S/C19H28F3NO4/c1-6-26-17(25-5)12-23-15(11-16(24)27-18(2,3)4)13-7-9-14(10-8-13)19(20,21)22/h7-10,15,17,23H,6,11-12H2,1-5H3 |
| InChIKey | WUCVTJUFPZDMQM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|