C23H25ClN6O — CID 146296076
4-[8-[(4-chlorophenyl)methyl]-5-(2-methylpropyl)-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine (PubChem CID 146296076) has the molecular formula C23H25ClN6O and a molecular weight of 436.95 g/mol. Its IUPAC name is 4-[8-[(4-chlorophenyl)methyl]-5-(2-methylpropyl)-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine.
| Compound Name | 4-[8-[(4-chlorophenyl)methyl]-5-(2-methylpropyl)-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine |
|---|---|
| PubChem CID | 146296076 |
| Molecular Formula | C23H25ClN6O |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-[8-[(4-chlorophenyl)methyl]-5-(2-methylpropyl)-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine |
| SMILES | CC(C)Cc1nnc2c3ncc(N4CCOCC4)cc3c(Cc3ccc(Cl)cc3)nn12 |
| InChI | InChI=1S/C23H25ClN6O/c1-15(2)11-21-26-27-23-22-19(13-18(14-25-22)29-7-9-31-10-8-29)20(28-30(21)23)12-16-3-5-17(24)6-4-16/h3-6,13-15H,7-12H2,1-2H3 |
| InChIKey | BFZLNWBUPQQJEJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |