C26H29ClN6O2 — CID 146301116
4-[8-[(4-chlorophenyl)methyl]-5-[1-(oxan-4-yl)ethyl]-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine (PubChem CID 146301116) has the molecular formula C26H29ClN6O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-[8-[(4-chlorophenyl)methyl]-5-[1-(oxan-4-yl)ethyl]-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine.
| Compound Name | 4-[8-[(4-chlorophenyl)methyl]-5-[1-(oxan-4-yl)ethyl]-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine |
|---|---|
| PubChem CID | 146301116 |
| Molecular Formula | C26H29ClN6O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-[8-[(4-chlorophenyl)methyl]-5-[1-(oxan-4-yl)ethyl]-3,4,6,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-11-yl]morpholine |
| SMILES | CC(c1nnc2c3ncc(N4CCOCC4)cc3c(Cc3ccc(Cl)cc3)nn12)C1CCOCC1 |
| InChI | InChI=1S/C26H29ClN6O2/c1-17(19-6-10-34-11-7-19)25-29-30-26-24-22(15-21(16-28-24)32-8-12-35-13-9-32)23(31-33(25)26)14-18-2-4-20(27)5-3-18/h2-5,15-17,19H,6-14H2,1H3 |
| InChIKey | UHOURYWXLYTVRS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |