C14H9ClF3N3O3S — CID 146301353
6-chloro-1,1-dioxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146301353) has the molecular formula C14H9ClF3N3O3S and a molecular weight of 391.76 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 6-chloro-1,1-dioxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301353 |
| Molecular Formula | C14H9ClF3N3O3S |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 6-chloro-1,1-dioxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cc2c(cc1Cl)NCNS2(=O)=O |
| InChI | InChI=1S/C14H9ClF3N3O3S/c15-8-4-11-12(25(23,24)20-5-19-11)3-7(8)14(22)21-6-1-9(16)13(18)10(17)2-6/h1-4,19-20H,5H2,(H,21,22) |
| InChIKey | HSVPYKDXHKABFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|