C17H10ClF3N4O3S2 — CID 146301241
6-chloro-1,1-dioxo-3-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146301241) has the molecular formula C17H10ClF3N4O3S2 and a molecular weight of 474.87 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-3-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 6-chloro-1,1-dioxo-3-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301241 |
| Molecular Formula | C17H10ClF3N4O3S2 |
| Molecular Weight | 474.87 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | 6-chloro-1,1-dioxo-3-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cc2c(cc1Cl)NC(c1nccs1)NS2(=O)=O |
| InChI | InChI=1S/C17H10ClF3N4O3S2/c18-9-6-12-13(30(27,28)25-15(24-12)17-22-1-2-29-17)5-8(9)16(26)23-7-3-10(19)14(21)11(20)4-7/h1-6,15,24-25H,(H,23,26) |
| InChIKey | VIAZKKAZURQLPQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|