C17H15BrF2N2O4 — CID 146309600
tert-butyl N-(2-bromo-4-nitrophenyl)-N-(2,4-difluorophenyl)carbamate (PubChem CID 146309600) has the molecular formula C17H15BrF2N2O4 and a molecular weight of 429.22 g/mol. Its IUPAC name is tert-butyl N-(2-bromo-4-nitrophenyl)-N-(2,4-difluorophenyl)carbamate.
| Compound Name | tert-butyl N-(2-bromo-4-nitrophenyl)-N-(2,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 146309600 |
| Molecular Formula | C17H15BrF2N2O4 |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | tert-butyl N-(2-bromo-4-nitrophenyl)-N-(2,4-difluorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(F)cc1F)c1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C17H15BrF2N2O4/c1-17(2,3)26-16(23)21(15-6-4-10(19)8-13(15)20)14-7-5-11(22(24)25)9-12(14)18/h4-9H,1-3H3 |
| InChIKey | PHAKPWZSLKJRPV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|