C19H19BrN2O2 — CID 146309830
1-(7-bromo-5-methyl-2,5-dihydro-1-benzoxepin-9-yl)-3-(4-methylphenyl)urea (PubChem CID 146309830) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 1-(7-bromo-5-methyl-2,5-dihydro-1-benzoxepin-9-yl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(7-bromo-5-methyl-2,5-dihydro-1-benzoxepin-9-yl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 146309830 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1-(7-bromo-5-methyl-2,5-dihydro-1-benzoxepin-9-yl)-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(Br)cc3c2OCC=CC3C)cc1 |
| InChI | InChI=1S/C19H19BrN2O2/c1-12-5-7-15(8-6-12)21-19(23)22-17-11-14(20)10-16-13(2)4-3-9-24-18(16)17/h3-8,10-11,13H,9H2,1-2H3,(H2,21,22,23) |
| InChIKey | RHVZBMMWBXSPLU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|