C17H17NO5 — CID 146312832
6-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-oxopyran-3-carboxylic acid (PubChem CID 146312832) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 6-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-oxopyran-3-carboxylic acid.
| Compound Name | 6-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-oxopyran-3-carboxylic acid |
|---|---|
| PubChem CID | 146312832 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 6-[4-(3-methoxypyrrolidin-1-yl)phenyl]-4-oxopyran-3-carboxylic acid |
| SMILES | COC1CCN(c2ccc(-c3cc(=O)c(C(=O)O)co3)cc2)C1 |
| InChI | InChI=1S/C17H17NO5/c1-22-13-6-7-18(9-13)12-4-2-11(3-5-12)16-8-15(19)14(10-23-16)17(20)21/h2-5,8,10,13H,6-7,9H2,1H3,(H,20,21) |
| InChIKey | REMXTARNCOJJPV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |