C19H21NO5 — CID 150761284
ethyl 6-[4-[(3R)-3-methoxypyrrolidin-1-yl]phenyl]-4-oxopyran-3-carboxylate (PubChem CID 150761284) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 6-[4-[(3R)-3-methoxypyrrolidin-1-yl]phenyl]-4-oxopyran-3-carboxylate.
| Compound Name | ethyl 6-[4-[(3R)-3-methoxypyrrolidin-1-yl]phenyl]-4-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 150761284 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 6-[4-[(3R)-3-methoxypyrrolidin-1-yl]phenyl]-4-oxopyran-3-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccc(N3CC[C@@H](OC)C3)cc2)cc1=O |
| InChI | InChI=1S/C19H21NO5/c1-3-24-19(22)16-12-25-18(10-17(16)21)13-4-6-14(7-5-13)20-9-8-15(11-20)23-2/h4-7,10,12,15H,3,8-9,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | JXWPLUAIYXKMDN-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |