C15H21BrN6O2S — CID 146312951
1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(4-bromophenyl)-(sulfinoamino)methyl]-3-methylpiperidine (PubChem CID 146312951) has the molecular formula C15H21BrN6O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(4-bromophenyl)-(sulfinoamino)methyl]-3-methylpiperidine.
| Compound Name | 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(4-bromophenyl)-(sulfinoamino)methyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 146312951 |
| Molecular Formula | C15H21BrN6O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(4-bromophenyl)-(sulfinoamino)methyl]-3-methylpiperidine |
| SMILES | CC1CN(c2n[nH]c(N)n2)CCC1C(NS(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN6O2S/c1-9-8-22(15-18-14(17)19-20-15)7-6-12(9)13(21-25(23)24)10-2-4-11(16)5-3-10/h2-5,9,12-13,21H,6-8H2,1H3,(H,23,24)(H3,17,18,19,20) |
| InChIKey | ZXHNKBYBCVXQSH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|