C23H18N4O4 — CID 146313558
3-(6-cyanopyridazin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 146313558) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 3-(6-cyanopyridazin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(6-cyanopyridazin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 146313558 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-(6-cyanopyridazin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | N#Cc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)nn1 |
| InChI | InChI=1S/C23H18N4O4/c24-12-15-10-9-14(26-27-15)11-21(22(28)29)25-23(30)31-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-10,20-21H,11,13H2,(H,25,30)(H,28,29) |
| InChIKey | VSQMSLGKHZMYST-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |