C25H29N5O4 — CID 146317243
7-methoxy-1-methyl-6-[2-[1-(methylamino)-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one (PubChem CID 146317243) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 7-methoxy-1-methyl-6-[2-[1-(methylamino)-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one.
| Compound Name | 7-methoxy-1-methyl-6-[2-[1-(methylamino)-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one |
|---|---|
| PubChem CID | 146317243 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 7-methoxy-1-methyl-6-[2-[1-(methylamino)-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one |
| SMILES | CNC(CCCCCC(=O)c1ncco1)c1ncc(-c2cc3ccc(=O)n(C)c3cc2OC)[nH]1 |
| InChI | InChI=1S/C25H29N5O4/c1-26-18(7-5-4-6-8-21(31)25-27-11-12-34-25)24-28-15-19(29-24)17-13-16-9-10-23(32)30(2)20(16)14-22(17)33-3/h9-15,18,26H,4-8H2,1-3H3,(H,28,29) |
| InChIKey | WIBVFQMKEMIZIW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|