C23H25N5O3 — CID 146317156
7-amino-7-[5-(7-methoxyquinolin-6-yl)-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one (PubChem CID 146317156) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 7-amino-7-[5-(7-methoxyquinolin-6-yl)-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one.
| Compound Name | 7-amino-7-[5-(7-methoxyquinolin-6-yl)-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 146317156 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 7-amino-7-[5-(7-methoxyquinolin-6-yl)-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one |
| SMILES | COc1cc2ncccc2cc1-c1cnc(C(N)CCCCCC(=O)c2ncco2)[nH]1 |
| InChI | InChI=1S/C23H25N5O3/c1-30-21-13-18-15(6-5-9-25-18)12-16(21)19-14-27-22(28-19)17(24)7-3-2-4-8-20(29)23-26-10-11-31-23/h5-6,9-14,17H,2-4,7-8,24H2,1H3,(H,27,28) |
| InChIKey | QLBWVAKBXBGPAX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|