C5H12F3NO6S — CID 146318678
2-amino-2-(hydroxymethyl)propane-1,3-diol;trifluoromethanesulfonic acid (PubChem CID 146318678) has the molecular formula C5H12F3NO6S and a molecular weight of 271.21 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;trifluoromethanesulfonic acid.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 146318678 |
| Molecular Formula | C5H12F3NO6S |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;trifluoromethanesulfonic acid |
| SMILES | NC(CO)(CO)CO.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C4H11NO3.CHF3O3S/c5-4(1-6,2-7)3-8;2-1(3,4)8(5,6)7/h6-8H,1-3,5H2;(H,5,6,7) |
| InChIKey | GQCMEPALZQNJKZ-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|