C20H30O5 — CID 146318706
(2E,4E,6E,8Z,10E)-8,14,15-trihydroxyicosa-2,4,6,8,10-pentaenoic acid (PubChem CID 146318706) has the molecular formula C20H30O5 and a molecular weight of 350.45 g/mol. Its IUPAC name is (2E,4E,6E,8Z,10E)-8,14,15-trihydroxyicosa-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2E,4E,6E,8Z,10E)-8,14,15-trihydroxyicosa-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 146318706 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2E,4E,6E,8Z,10E)-8,14,15-trihydroxyicosa-2,4,6,8,10-pentaenoic acid |
| SMILES | CCCCCC(O)C(O)CC/C=C/C=C(O)/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-7-14-18(22)19(23)15-10-6-9-13-17(21)12-8-4-5-11-16-20(24)25/h4-6,8-9,11-13,16,18-19,21-23H,2-3,7,10,14-15H2,1H3,(H,24,25)/b5-4+,9-6+,12-8+,16-11+,17-13- |
| InChIKey | SGJHQWMLAAQPNV-QOYJPPBWSA-N |
| XLogP | 3.82 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|