C22H32O4 — CID 90011466
(17S)-10,17-dihydroxydocosa-2,4,6,8,10,12-hexaenoic acid (PubChem CID 90011466) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (17S)-10,17-dihydroxydocosa-2,4,6,8,10,12-hexaenoic acid.
| Compound Name | (17S)-10,17-dihydroxydocosa-2,4,6,8,10,12-hexaenoic acid |
|---|---|
| PubChem CID | 90011466 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (17S)-10,17-dihydroxydocosa-2,4,6,8,10,12-hexaenoic acid |
| SMILES | CCCCC[C@H](O)CCCC=CC=C(O)C=CC=CC=CC=CC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h4-7,9,11,13-14,16,18-20,23-24H,2-3,8,10,12,15,17H2,1H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | ODRSMSILHLPXQH-FQEVSTJZSA-N |
| XLogP | 5.41 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|