C39H43N3O8 — CID 146321332
4-O-(4,6-dimethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl) 1-O-[2-(4-tritylpiperazine-1-carbonyl)oxyethyl] butanedioate (PubChem CID 146321332) has the molecular formula C39H43N3O8 and a molecular weight of 681.79 g/mol. Its IUPAC name is 4-O-(4,6-dimethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl) 1-O-[2-(4-tritylpiperazine-1-carbonyl)oxyethyl] butanedioate.
| Compound Name | 4-O-(4,6-dimethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl) 1-O-[2-(4-tritylpiperazine-1-carbonyl)oxyethyl] butanedioate |
|---|---|
| PubChem CID | 146321332 |
| Molecular Formula | C39H43N3O8 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | 4-O-(4,6-dimethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl) 1-O-[2-(4-tritylpiperazine-1-carbonyl)oxyethyl] butanedioate |
| SMILES | CC1CC(C)C2C(=O)N(OC(=O)CCC(=O)OCCOC(=O)N3CCN(C(c4ccccc4)(c4ccccc4)c4ccccc4)CC3)C(=O)C12 |
| InChI | InChI=1S/C39H43N3O8/c1-27-26-28(2)35-34(27)36(45)42(37(35)46)50-33(44)19-18-32(43)48-24-25-49-38(47)40-20-22-41(23-21-40)39(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-17,27-28,34-35H,18-26H2,1-2H3 |
| InChIKey | KRQKKUOLCHDPTR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|