C43H49N3O9 — CID 156550834
4-O-[(1R,6R,7S)-3-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 1-O-[2-[2-[2-(4-tritylpiperazine-1-carbonyl)oxyethoxy]ethoxy]ethyl] butanedioate (PubChem CID 156550834) has the molecular formula C43H49N3O9 and a molecular weight of 751.88 g/mol. Its IUPAC name is 4-O-[(1R,6R,7S)-3-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 1-O-[2-[2-[2-(4-tritylpiperazine-1-carbonyl)oxyethoxy]ethoxy]ethyl] butanedioate.
| Compound Name | 4-O-[(1R,6R,7S)-3-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 1-O-[2-[2-[2-(4-tritylpiperazine-1-carbonyl)oxyethoxy]ethoxy]ethyl] butanedioate |
|---|---|
| PubChem CID | 156550834 |
| Molecular Formula | C43H49N3O9 |
| Molecular Weight | 751.88 g/mol |
| Exact Mass | 751.35 |
| IUPAC Name | 4-O-[(1R,6R,7S)-3-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 1-O-[2-[2-[2-(4-tritylpiperazine-1-carbonyl)oxyethoxy]ethoxy]ethyl] butanedioate |
| SMILES | O=C(CCC(=O)ON1C[C@H]2C(C1=O)[C@H]1C=C[C@@H]2C1)OCCOCCOCCOC(=O)N1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C43H49N3O9/c47-38(18-19-39(48)55-46-31-37-32-16-17-33(30-32)40(37)41(46)49)53-28-26-51-24-25-52-27-29-54-42(50)44-20-22-45(23-21-44)43(34-10-4-1-5-11-34,35-12-6-2-7-13-35)36-14-8-3-9-15-36/h1-17,32-33,37,40H,18-31H2/t32-,33+,37-,40?/m1/s1 |
| InChIKey | SJLIZVAVVWZVIY-YJGBPIODSA-N |
| XLogP | 4.83 |
| TPSA | 124.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|