C18H18N2O4 — CID 50876966
benzyl N-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]carbamate (PubChem CID 50876966) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is benzyl N-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]carbamate.
| Compound Name | benzyl N-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 50876966 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | benzyl N-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]carbamate |
| SMILES | O=C(NCN1C(=O)C2C3C=CC(C3)C2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O4/c21-16-14-12-6-7-13(8-12)15(14)17(22)20(16)10-19-18(23)24-9-11-4-2-1-3-5-11/h1-7,12-15H,8-10H2,(H,19,23) |
| InChIKey | MFPQSLDYDCIBBG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|