C30H27N3O10 — CID 20593281
bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 2-(phenylmethoxycarbonylamino)butanedioate (PubChem CID 20593281) has the molecular formula C30H27N3O10 and a molecular weight of 589.56 g/mol. Its IUPAC name is bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 2-(phenylmethoxycarbonylamino)butanedioate.
| Compound Name | bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 2-(phenylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 20593281 |
| Molecular Formula | C30H27N3O10 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) 2-(phenylmethoxycarbonylamino)butanedioate |
| SMILES | O=C(CC(NC(=O)OCc1ccccc1)C(=O)ON1C(=O)C2C3C=CC(C3)C2C1=O)ON1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C30H27N3O10/c34-20(42-32-25(35)21-15-6-7-16(10-15)22(21)26(32)36)12-19(31-30(40)41-13-14-4-2-1-3-5-14)29(39)43-33-27(37)23-17-8-9-18(11-17)24(23)28(33)38/h1-9,15-19,21-24H,10-13H2,(H,31,40) |
| InChIKey | ULMJKBDNHVCVPZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|