C19H21NO4 — CID 75114895
4-(2-hydroxy-3-phenylmethoxypropyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 75114895) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-(2-hydroxy-3-phenylmethoxypropyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-(2-hydroxy-3-phenylmethoxypropyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 75114895 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-(2-hydroxy-3-phenylmethoxypropyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1CC(O)COCc1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c21-15(11-24-10-12-4-2-1-3-5-12)9-20-18(22)16-13-6-7-14(8-13)17(16)19(20)23/h1-7,13-17,21H,8-11H2 |
| InChIKey | GHFRKJQLGUMDMK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|