About 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide
2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide (PubChem CID 146323287) has the molecular formula C11H7ClF3N3O3
and a molecular weight of 321.64 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 146323287 |
| Molecular Formula | C11H7ClF3N3O3 |
| Molecular Weight | 321.64 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CC(F)F)c1)c1coc(Cl)n1 |
| InChI | InChI=1S/C11H7ClF3N3O3/c12-11-17-7(4-21-11)9(19)16-5-1-6(13)10(20)18(2-5)3-8(14)15/h1-2,4,8H,3H2,(H,16,19) |
| InChIKey | JGFDHTDQCWJRQI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide (CID 146323287) is 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide is O=C(Nc1cc(F)c(=O)n(CC(F)F)c1)c1coc(Cl)n1.
What is the InChIKey of 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide?
The InChIKey is JGFDHTDQCWJRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClF3N3O3/c12-11-17-7(4-21-11)9(19)16-5-1-6(13)10(20)18(2-5)3-8(14)15/h1-2,4,8H,3H2,(H,16,19).
What are the key properties of 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide?
2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide has a molecular weight of 321.64 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 146323287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).