C13H11ClF3N3O2S — CID 166024139
4-chloro-5-cyano-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide (PubChem CID 166024139) has the molecular formula C13H11ClF3N3O2S and a molecular weight of 365.76 g/mol. Its IUPAC name is 4-chloro-5-cyano-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide.
| Compound Name | 4-chloro-5-cyano-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024139 |
| Molecular Formula | C13H11ClF3N3O2S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 4-chloro-5-cyano-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
| SMILES | N#CC1SC(C(=O)Nc2cc(F)c(=O)n(CC(F)F)c2)CC1Cl |
| InChI | InChI=1S/C13H11ClF3N3O2S/c14-7-2-9(23-10(7)3-18)12(21)19-6-1-8(15)13(22)20(4-6)5-11(16)17/h1,4,7,9-11H,2,5H2,(H,19,21) |
| InChIKey | JUYNKPHYBHKDOM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|