C13H14ClF3N2O2S2 — CID 166024073
5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-4-methylsulfanylthiolane-2-carboxamide (PubChem CID 166024073) has the molecular formula C13H14ClF3N2O2S2 and a molecular weight of 386.85 g/mol. Its IUPAC name is 5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-4-methylsulfanylthiolane-2-carboxamide.
| Compound Name | 5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-4-methylsulfanylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024073 |
| Molecular Formula | C13H14ClF3N2O2S2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-4-methylsulfanylthiolane-2-carboxamide |
| SMILES | CSC1CC(C(=O)Nc2cc(F)c(=O)n(CC(F)F)c2)SC1Cl |
| InChI | InChI=1S/C13H14ClF3N2O2S2/c1-22-8-3-9(23-11(8)14)12(20)18-6-2-7(15)13(21)19(4-6)5-10(16)17/h2,4,8-11H,3,5H2,1H3,(H,18,20) |
| InChIKey | RJDHRHBTSNPIMO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|