C14H16ClF2N3O3S — CID 166024240
5-acetamido-4-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]thiolane-2-carboxamide (PubChem CID 166024240) has the molecular formula C14H16ClF2N3O3S and a molecular weight of 379.82 g/mol. Its IUPAC name is 5-acetamido-4-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]thiolane-2-carboxamide.
| Compound Name | 5-acetamido-4-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024240 |
| Molecular Formula | C14H16ClF2N3O3S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-acetamido-4-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
| SMILES | CC(=O)NC1SC(C(=O)Nc2cc(F)c(=O)n(CCF)c2)CC1Cl |
| InChI | InChI=1S/C14H16ClF2N3O3S/c1-7(21)18-13-9(15)5-11(24-13)12(22)19-8-4-10(17)14(23)20(6-8)3-2-16/h4,6,9,11,13H,2-3,5H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | IYCMCEKXLWXGJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|