C13H16F2N2O4S2 — CID 166024375
N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-5-methylsulfonylthiolane-2-carboxamide (PubChem CID 166024375) has the molecular formula C13H16F2N2O4S2 and a molecular weight of 366.41 g/mol. Its IUPAC name is N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-5-methylsulfonylthiolane-2-carboxamide.
| Compound Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-5-methylsulfonylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024375 |
| Molecular Formula | C13H16F2N2O4S2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-5-methylsulfonylthiolane-2-carboxamide |
| SMILES | CS(=O)(=O)C1CCC(C(=O)Nc2cc(F)c(=O)n(CCF)c2)S1 |
| InChI | InChI=1S/C13H16F2N2O4S2/c1-23(20,21)11-3-2-10(22-11)12(18)16-8-6-9(15)13(19)17(7-8)5-4-14/h6-7,10-11H,2-5H2,1H3,(H,16,18) |
| InChIKey | YFOYUPGWJOVTIO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |