C12H15Cl2FN4O2 — CID 166024364
2-chloro-N-[5-chloro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-3-methylimidazolidine-4-carboxamide (PubChem CID 166024364) has the molecular formula C12H15Cl2FN4O2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-3-methylimidazolidine-4-carboxamide.
| Compound Name | 2-chloro-N-[5-chloro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-3-methylimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 166024364 |
| Molecular Formula | C12H15Cl2FN4O2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-chloro-N-[5-chloro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-3-methylimidazolidine-4-carboxamide |
| SMILES | CN1C(Cl)NCC1C(=O)Nc1cc(Cl)c(=O)n(CCF)c1 |
| InChI | InChI=1S/C12H15Cl2FN4O2/c1-18-9(5-16-12(18)14)10(20)17-7-4-8(13)11(21)19(6-7)3-2-15/h4,6,9,12,16H,2-3,5H2,1H3,(H,17,20) |
| InChIKey | NXRKICPIXDWPLQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|