C15H15ClFN5O2 — CID 166024255
4-chloro-5-cyano-N-[5-cyano-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methylpyrrolidine-2-carboxamide (PubChem CID 166024255) has the molecular formula C15H15ClFN5O2 and a molecular weight of 351.77 g/mol. Its IUPAC name is 4-chloro-5-cyano-N-[5-cyano-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methylpyrrolidine-2-carboxamide.
| Compound Name | 4-chloro-5-cyano-N-[5-cyano-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166024255 |
| Molecular Formula | C15H15ClFN5O2 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-chloro-5-cyano-N-[5-cyano-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES | CN1C(C(=O)Nc2cc(C#N)c(=O)n(CCF)c2)CC(Cl)C1C#N |
| InChI | InChI=1S/C15H15ClFN5O2/c1-21-12(5-11(16)13(21)7-19)14(23)20-10-4-9(6-18)15(24)22(8-10)3-2-17/h4,8,11-13H,2-3,5H2,1H3,(H,20,23) |
| InChIKey | DIQFQPGTCSYCAZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|