C20H21Cl2F3N2O2S — CID 166024321
5-chloro-4-[2-(4-chlorocyclohexyl)ethynyl]-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide (PubChem CID 166024321) has the molecular formula C20H21Cl2F3N2O2S and a molecular weight of 481.37 g/mol. Its IUPAC name is 5-chloro-4-[2-(4-chlorocyclohexyl)ethynyl]-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide.
| Compound Name | 5-chloro-4-[2-(4-chlorocyclohexyl)ethynyl]-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024321 |
| Molecular Formula | C20H21Cl2F3N2O2S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-chloro-4-[2-(4-chlorocyclohexyl)ethynyl]-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CC(F)F)c1)C1CC(C#CC2CCC(Cl)CC2)C(Cl)S1 |
| InChI | InChI=1S/C20H21Cl2F3N2O2S/c21-13-5-2-11(3-6-13)1-4-12-7-16(30-18(12)22)19(28)26-14-8-15(23)20(29)27(9-14)10-17(24)25/h8-9,11-13,16-18H,2-3,5-7,10H2,(H,26,28) |
| InChIKey | XAXKNJZVKZYWHQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|