C22H25ClF3N3O4S — CID 166024112
tert-butyl 3-[2-[2-chloro-5-[[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]carbamoyl]thiolan-3-yl]ethynyl]azetidine-1-carboxylate (PubChem CID 166024112) has the molecular formula C22H25ClF3N3O4S and a molecular weight of 519.97 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-chloro-5-[[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]carbamoyl]thiolan-3-yl]ethynyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-chloro-5-[[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]carbamoyl]thiolan-3-yl]ethynyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 166024112 |
| Molecular Formula | C22H25ClF3N3O4S |
| Molecular Weight | 519.97 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | tert-butyl 3-[2-[2-chloro-5-[[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]carbamoyl]thiolan-3-yl]ethynyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C#CC2CC(C(=O)Nc3cc(F)c(=O)n(CC(F)F)c3)SC2Cl)C1 |
| InChI | InChI=1S/C22H25ClF3N3O4S/c1-22(2,3)33-21(32)29-8-12(9-29)4-5-13-6-16(34-18(13)23)19(30)27-14-7-15(24)20(31)28(10-14)11-17(25)26/h7,10,12-13,16-18H,6,8-9,11H2,1-3H3,(H,27,30) |
| InChIKey | SRPUAVCFOHPBNO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|