C21H24ClF3N4O2S — CID 166024019
4-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl)ethynyl]-5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide (PubChem CID 166024019) has the molecular formula C21H24ClF3N4O2S and a molecular weight of 488.96 g/mol. Its IUPAC name is 4-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl)ethynyl]-5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide.
| Compound Name | 4-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl)ethynyl]-5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024019 |
| Molecular Formula | C21H24ClF3N4O2S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl)ethynyl]-5-chloro-N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]thiolane-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CC(F)F)c1)C1CC(C#CC2CN3CCCCC3N2)C(Cl)S1 |
| InChI | InChI=1S/C21H24ClF3N4O2S/c22-19-12(4-5-13-9-28-6-2-1-3-18(28)26-13)7-16(32-19)20(30)27-14-8-15(23)21(31)29(10-14)11-17(24)25/h8,10,12-13,16-19,26H,1-3,6-7,9,11H2,(H,27,30) |
| InChIKey | CHBSZVQZAIPUCH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|