About 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide
4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide (PubChem CID 166024317) has the molecular formula C12H14Cl2N2O2S
and a molecular weight of 321.23 g/mol. Its IUPAC name is 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide |
| PubChem CID | 166024317 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CC(Cl)C(Cl)S2)cn(C)c1=O |
| InChI | InChI=1S/C12H14Cl2N2O2S/c1-6-3-7(5-16(2)12(6)18)15-11(17)9-4-8(13)10(14)19-9/h3,5,8-10H,4H2,1-2H3,(H,15,17) |
| InChIKey | RHASPCZMVKFWDP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide?
The IUPAC name of 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide (CID 166024317) is 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide.
What is the SMILES notation for 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide?
The canonical SMILES for 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide is Cc1cc(NC(=O)C2CC(Cl)C(Cl)S2)cn(C)c1=O.
What is the InChIKey of 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide?
The InChIKey is RHASPCZMVKFWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O2S/c1-6-3-7(5-16(2)12(6)18)15-11(17)9-4-8(13)10(14)19-9/h3,5,8-10H,4H2,1-2H3,(H,15,17).
What are the key properties of 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide?
4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide has a molecular weight of 321.23 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide is sourced from PubChem (CID 166024317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).