C12H14Cl2N2O2S — CID 166024317
4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide (PubChem CID 166024317) has the molecular formula C12H14Cl2N2O2S and a molecular weight of 321.23 g/mol. Its IUPAC name is 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide |
|---|---|
| PubChem CID | 166024317 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4,5-dichloro-N-(1,5-dimethyl-6-oxo-3-pyridinyl)thiolane-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CC(Cl)C(Cl)S2)cn(C)c1=O |
| InChI | InChI=1S/C12H14Cl2N2O2S/c1-6-3-7(5-16(2)12(6)18)15-11(17)9-4-8(13)10(14)19-9/h3,5,8-10H,4H2,1-2H3,(H,15,17) |
| InChIKey | RHASPCZMVKFWDP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|