C15H18ClF2N3O3S — CID 166024244
5-chloro-2-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-4-N,4-N-dimethylthiolane-2,4-dicarboxamide (PubChem CID 166024244) has the molecular formula C15H18ClF2N3O3S and a molecular weight of 393.84 g/mol. Its IUPAC name is 5-chloro-2-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-4-N,4-N-dimethylthiolane-2,4-dicarboxamide.
| Compound Name | 5-chloro-2-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-4-N,4-N-dimethylthiolane-2,4-dicarboxamide |
|---|---|
| PubChem CID | 166024244 |
| Molecular Formula | C15H18ClF2N3O3S |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 5-chloro-2-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-4-N,4-N-dimethylthiolane-2,4-dicarboxamide |
| SMILES | CN(C)C(=O)C1CC(C(=O)Nc2cc(F)c(=O)n(CCF)c2)SC1Cl |
| InChI | InChI=1S/C15H18ClF2N3O3S/c1-20(2)14(23)9-6-11(25-12(9)16)13(22)19-8-5-10(18)15(24)21(7-8)4-3-17/h5,7,9,11-12H,3-4,6H2,1-2H3,(H,19,22) |
| InChIKey | UGAKMYFXDHIQCN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|