C11H20ClFO — CID 146324171
2-chloro-4-(3,3-dimethylbutyl)-6-fluorooxane (PubChem CID 146324171) has the molecular formula C11H20ClFO and a molecular weight of 222.73 g/mol. Its IUPAC name is 2-chloro-4-(3,3-dimethylbutyl)-6-fluorooxane.
| Compound Name | 2-chloro-4-(3,3-dimethylbutyl)-6-fluorooxane |
|---|---|
| PubChem CID | 146324171 |
| Molecular Formula | C11H20ClFO |
| Molecular Weight | 222.73 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-chloro-4-(3,3-dimethylbutyl)-6-fluorooxane |
| SMILES | CC(C)(C)CCC1CC(F)OC(Cl)C1 |
| InChI | InChI=1S/C11H20ClFO/c1-11(2,3)5-4-8-6-9(12)14-10(13)7-8/h8-10H,4-7H2,1-3H3 |
| InChIKey | AUQWPSXZRCGEHW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|