C8H6BrIN2OS — CID 146326744
(4-bromo-2-methyl-7-oxo-6H-pyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite (PubChem CID 146326744) has the molecular formula C8H6BrIN2OS and a molecular weight of 385.02 g/mol. Its IUPAC name is (4-bromo-2-methyl-7-oxo-6H-pyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite.
| Compound Name | (4-bromo-2-methyl-7-oxo-6H-pyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite |
|---|---|
| PubChem CID | 146326744 |
| Molecular Formula | C8H6BrIN2OS |
| Molecular Weight | 385.02 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | (4-bromo-2-methyl-7-oxo-6H-pyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite |
| SMILES | Cc1cc2c(Br)c[nH]c(=O)c2n1SI |
| InChI | InChI=1S/C8H6BrIN2OS/c1-4-2-5-6(9)3-11-8(13)7(5)12(4)14-10/h2-3H,1H3,(H,11,13) |
| InChIKey | KOFKRJBMSFYVDB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.02 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|