C9H6BrIN2O2S — CID 176938584
(4-bromo-2-formyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite (PubChem CID 176938584) has the molecular formula C9H6BrIN2O2S and a molecular weight of 413.03 g/mol. Its IUPAC name is (4-bromo-2-formyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite.
| Compound Name | (4-bromo-2-formyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite |
|---|---|
| PubChem CID | 176938584 |
| Molecular Formula | C9H6BrIN2O2S |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 411.84 |
| IUPAC Name | (4-bromo-2-formyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl) thiohypoiodite |
| SMILES | Cn1cc(Br)c2cc(C=O)n(SI)c2c1=O |
| InChI | InChI=1S/C9H6BrIN2O2S/c1-12-3-7(10)6-2-5(4-14)13(16-11)8(6)9(12)15/h2-4H,1H3 |
| InChIKey | AGBDJOHIPSCGPX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|