C20H23NO9S — CID 146336210
[4-[2,2-dihydroxy-1-(phenylmethoxycarbonylamino)ethyl]phenyl] 3-methoxysulfonylpropanoate (PubChem CID 146336210) has the molecular formula C20H23NO9S and a molecular weight of 453.47 g/mol. Its IUPAC name is [4-[2,2-dihydroxy-1-(phenylmethoxycarbonylamino)ethyl]phenyl] 3-methoxysulfonylpropanoate.
| Compound Name | [4-[2,2-dihydroxy-1-(phenylmethoxycarbonylamino)ethyl]phenyl] 3-methoxysulfonylpropanoate |
|---|---|
| PubChem CID | 146336210 |
| Molecular Formula | C20H23NO9S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [4-[2,2-dihydroxy-1-(phenylmethoxycarbonylamino)ethyl]phenyl] 3-methoxysulfonylpropanoate |
| SMILES | COS(=O)(=O)CCC(=O)Oc1ccc(C(NC(=O)OCc2ccccc2)C(O)O)cc1 |
| InChI | InChI=1S/C20H23NO9S/c1-28-31(26,27)12-11-17(22)30-16-9-7-15(8-10-16)18(19(23)24)21-20(25)29-13-14-5-3-2-4-6-14/h2-10,18-19,23-24H,11-13H2,1H3,(H,21,25) |
| InChIKey | BCAKSMZTUQQQFN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|